Difference between revisions of "SJ02256"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3709 CPD-3709] == * common-name: ** guanosine 2',3'-cyclic monophosphate * smiles: ** c(o)c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-specific-UCP-E2-L-cysteine N-terminal-specific-UCP-E2-L-cysteine] == * common-name:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3709 CPD-3709] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-specific-UCP-E2-L-cysteine N-terminal-specific-UCP-E2-L-cysteine] ==
 
* common-name:
 
* common-name:
** guanosine 2',3'-cyclic monophosphate
+
** an [n-terminal e2 ubiquitin-conjugating enzyme]-l-cysteine
* smiles:
 
** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)))
 
* inchi-key:
 
** uasryodfrywbrc-uuokfmhzsa-m
 
* molecular-weight:
 
** 344.2
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12058]]
+
* [[RXN-15563]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15564]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=guanosine 2',3'-cyclic monophosphate}}
+
{{#set: common-name=an [n-terminal e2 ubiquitin-conjugating enzyme]-l-cysteine}}
{{#set: inchi-key=inchikey=uasryodfrywbrc-uuokfmhzsa-m}}
 
{{#set: molecular-weight=344.2}}
 

Revision as of 09:24, 27 August 2019

Metabolite N-terminal-specific-UCP-E2-L-cysteine

  • common-name:
    • an [n-terminal e2 ubiquitin-conjugating enzyme]-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [n-terminal e2 ubiquitin-conjugating enzyme]-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.