Difference between revisions of "SJ02256"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tau-proteins Tau-proteins] == * common-name: ** a tau protein == Reaction(s) known to consume t...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3709 CPD-3709] == * common-name: ** guanosine 2',3'-cyclic monophosphate * smiles: ** c(o)c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3709 CPD-3709] == |
* common-name: | * common-name: | ||
− | ** | + | ** guanosine 2',3'-cyclic monophosphate |
+ | * smiles: | ||
+ | ** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34))) | ||
+ | * inchi-key: | ||
+ | ** uasryodfrywbrc-uuokfmhzsa-m | ||
+ | * molecular-weight: | ||
+ | ** 344.2 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12058]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=guanosine 2',3'-cyclic monophosphate}} |
+ | {{#set: inchi-key=inchikey=uasryodfrywbrc-uuokfmhzsa-m}} | ||
+ | {{#set: molecular-weight=344.2}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-3709
- common-name:
- guanosine 2',3'-cyclic monophosphate
- smiles:
- c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)))
- inchi-key:
- uasryodfrywbrc-uuokfmhzsa-m
- molecular-weight:
- 344.2