Difference between revisions of "SJ02299"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13855 CPD-13855] == * common-name: ** n7-methylguanosine 5'-diphosphate * smiles: ** c[n+]1...")
(Created page with "Category:gene == Gene SJ02299 == * transcription-direction: ** negative * right-end-position: ** 64701 * left-end-position: ** 52098 * centisome-position: ** 37.571396...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13855 CPD-13855] ==
+
== Gene SJ02299 ==
* common-name:
+
* transcription-direction:
** n7-methylguanosine 5'-diphosphate
+
** negative
* smiles:
+
* right-end-position:
** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])op([o-])([o-])=o)c(o)c(o)3))
+
** 64701
* inchi-key:
+
* left-end-position:
** sbasprrecyvbrf-kqynxxcusa-l
+
** 52098
* molecular-weight:
+
* centisome-position:
** 455.214
+
** 37.571396   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-12817]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-12817]]
+
* [[PROTEIN-KINASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=n7-methylguanosine 5'-diphosphate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=sbasprrecyvbrf-kqynxxcusa-l}}
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
{{#set: molecular-weight=455.214}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-7511]]
 +
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=64701}}
 +
{{#set: left-end-position=52098}}
 +
{{#set: centisome-position=37.571396    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ02299

  • transcription-direction:
    • negative
  • right-end-position:
    • 64701
  • left-end-position:
    • 52098
  • centisome-position:
    • 37.571396

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway