Difference between revisions of "SJ02303"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11522 CPD-11522] == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-en...")
(Created page with "Category:gene == Gene SJ02303 == * transcription-direction: ** positive * right-end-position: ** 94200 * left-end-position: ** 82245 * centisome-position: ** 59.33041...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11522 CPD-11522] ==
+
== Gene SJ02303 ==
* common-name:
+
* transcription-direction:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa
+
** positive
* smiles:
+
* right-end-position:
** ccc=ccc1(c(ccc(=o)1)cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
+
** 94200
* inchi-key:
+
* left-end-position:
** ieeneqseowxdqk-dioafzbusa-j
+
** 82245
* molecular-weight:
+
* centisome-position:
** 1009.851
+
** 59.33041   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-10704]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-10706]]
+
* [[DISULFOXRED-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-hexa-2-enoyl)-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=ieeneqseowxdqk-dioafzbusa-j}}
+
{{#set: transcription-direction=positive}}
{{#set: molecular-weight=1009.851}}
+
{{#set: right-end-position=94200}}
 +
{{#set: left-end-position=82245}}
 +
{{#set: centisome-position=59.33041    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:04, 18 March 2021

Gene SJ02303

  • transcription-direction:
    • positive
  • right-end-position:
    • 94200
  • left-end-position:
    • 82245
  • centisome-position:
    • 59.33041

Organism(s) associated with this gene

Reaction(s) associated