Difference between revisions of "SJ02308"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-34-BISPHOSPHATE D-MYO-INOSITOL-34-BISPHOSPHATE] == * common-name: ** d-myo-inosi...")
(Created page with "Category:gene == Gene SJ02308 == * transcription-direction: ** negative * right-end-position: ** 23125 * left-end-position: ** 20058 * centisome-position: ** 14.469565...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-34-BISPHOSPHATE D-MYO-INOSITOL-34-BISPHOSPHATE] ==
+
== Gene SJ02308 ==
−
* common-name:
+
* transcription-direction:
−
** d-myo-inositol (3,4)-bisphosphate
+
** negative
−
* smiles:
+
* right-end-position:
−
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
+
** 23125
−
* inchi-key:
+
* left-end-position:
−
** mckajxmrulsuki-cnwjwelysa-j
+
** 20058
−
* molecular-weight:
+
* centisome-position:
−
** 336.085
+
** 14.469565   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-10960]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-10939]]
+
* [[RXN-12456]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=d-myo-inositol (3,4)-bisphosphate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=mckajxmrulsuki-cnwjwelysa-j}}
+
* [[RXN0-1281]]
−
{{#set: molecular-weight=336.085}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=23125}}
 +
{{#set: left-end-position=20058}}
 +
{{#set: centisome-position=14.469565    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:04, 18 March 2021

Gene SJ02308

  • transcription-direction:
    • negative
  • right-end-position:
    • 23125
  • left-end-position:
    • 20058
  • centisome-position:
    • 14.469565

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ02308&oldid=133433"