Difference between revisions of "SJ02315"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-178 CPD-178] == * common-name: ** d-myo-inositol (3,4,5,6)-tetrakisphosphate * smiles: ** c...")
(Created page with "Category:gene == Gene SJ02315 == * transcription-direction: ** positive * right-end-position: ** 134907 * left-end-position: ** 133726 * centisome-position: ** 96.672424...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-178 CPD-178] ==
+
== Gene SJ02315 ==
* common-name:
+
* transcription-direction:
** d-myo-inositol (3,4,5,6)-tetrakisphosphate
+
** positive
* smiles:
+
* right-end-position:
** c1(o)(c(o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
+
** 134907
* inchi-key:
+
* left-end-position:
** mrvyfoanpdtyby-uzaagftcsa-f
+
** 133726
* molecular-weight:
+
* centisome-position:
** 492.013
+
** 96.672424   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[2.7.1.134-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[3.1.26.4-RXN]]
{{#set: common-name=d-myo-inositol (3,4,5,6)-tetrakisphosphate}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=mrvyfoanpdtyby-uzaagftcsa-f}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=492.013}}
+
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=134907}}
 +
{{#set: left-end-position=133726}}
 +
{{#set: centisome-position=96.672424    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}

Latest revision as of 11:03, 18 March 2021

Gene SJ02315

  • transcription-direction:
    • positive
  • right-end-position:
    • 134907
  • left-end-position:
    • 133726
  • centisome-position:
    • 96.672424

Organism(s) associated with this gene

Reaction(s) associated