Difference between revisions of "SJ02350"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] == * common-name: ** apigenin * smiles: ** c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCAA-dehydrogenase-lipoyl BCAA-dehydrogenase-lipoyl] == * common-name: ** an [apo bcaa dehydrog...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-431 CPD-431] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCAA-dehydrogenase-lipoyl BCAA-dehydrogenase-lipoyl] ==
 
* common-name:
 
* common-name:
** apigenin
+
** an [apo bcaa dehydrogenase e2 protein] n6-lipoyl-l-lysine
* smiles:
 
** c1(c=c(o)c=cc=1c3(=cc(=o)c2(=c(c=c([o-])c=c(o)2)o3)))
 
* inchi-key:
 
** kznifhplkgyrtm-uhfffaoysa-m
 
* molecular-weight:
 
** 269.233
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7651]]
+
* [[1.2.4.4-RXN]]
 +
* [[KETOISOCAPROATE-RXN]]
 +
* [[METHYLVALERATE-RXN]]
 +
* [[RXN-7719]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.2.4.4-RXN]]
 +
* [[METHYLVALERATE-RXN]]
 +
* [[RXN-7719]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=apigenin}}
+
{{#set: common-name=an [apo bcaa dehydrogenase e2 protein] n6-lipoyl-l-lysine}}
{{#set: inchi-key=inchikey=kznifhplkgyrtm-uhfffaoysa-m}}
 
{{#set: molecular-weight=269.233}}
 

Revision as of 14:19, 26 August 2019

Metabolite BCAA-dehydrogenase-lipoyl

  • common-name:
    • an [apo bcaa dehydrogenase e2 protein] n6-lipoyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [apo bcaa dehydrogenase e2 protein] n6-lipoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.