Difference between revisions of "SJ02381"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] == * common-name: ** aldehydo-d-ribose 5-phosphate * smiles: ** [ch](=o)c(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THYMIDINE THYMIDINE] == * common-name: ** thymidine * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THYMIDINE THYMIDINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** thymidine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** iqfyykkmvgjfeh-xlpzgreqsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 242.231 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[TPH]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thymidine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=iqfyykkmvgjfeh-xlpzgreqsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=242.231}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite THYMIDINE
- common-name:
- thymidine
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2))
- inchi-key:
- iqfyykkmvgjfeh-xlpzgreqsa-n
- molecular-weight:
- 242.231
