Difference between revisions of "SJ02381"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THYMIDINE THYMIDINE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G3P G3P] ==
 * common-name:
-** thymidine
+** 3-phospho-d-glycerate
 * smiles:
-** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2))
+** c(op(=o)([o-])[o-])c(o)c(=o)[o-]
 * inchi-key:
-** iqfyykkmvgjfeh-xlpzgreqsa-n
+** osjppgntcrnqqc-uwtatzphsa-k
 * molecular-weight:
-** 242.231
+** 183.034
 == Reaction(s) known to consume the compound ==
+* [[3PGAREARR-RXN]]
+* [[PGLYCDEHYDROG-RXN]]
+* [[PHOSGLYPHOS-RXN]]
+* [[RXN-15511]]
+* [[RXN-15513]]
+* [[RXN-17276]]
 == Reaction(s) known to produce the compound ==
-* [[TPH]]
+* [[3PGAREARR-RXN]]
+* [[GLY3KIN-RXN]]
+* [[PGLYCDEHYDROG-RXN]]
+* [[PHOSGLYPHOS-RXN]]
+* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
+* [[RXN-15511]]
+* [[RXN-15513]]
+* [[RXN-17274]]
+* [[RXN-3443]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=thymidine}}
+{{#set: common-name=3-phospho-d-glycerate}}
-{{#set: inchi-key=inchikey=iqfyykkmvgjfeh-xlpzgreqsa-n}}
+{{#set: inchi-key=inchikey=osjppgntcrnqqc-uwtatzphsa-k}}
-{{#set: molecular-weight=242.231}}
+{{#set: molecular-weight=183.034}}