Difference between revisions of "SJ02381"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G3P G3P] == * common-name: ** 3-phospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(o)c(=o)[o...")
(Created page with "Category:gene == Gene SJ14827 == * transcription-direction: ** positive * right-end-position: ** 37271 * left-end-position: ** 24783 * centisome-position: ** 6.1753097...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G3P G3P] ==
+
== Gene SJ14827 ==
* common-name:
+
* transcription-direction:
** 3-phospho-d-glycerate
+
** positive
* smiles:
+
* right-end-position:
** c(op(=o)([o-])[o-])c(o)c(=o)[o-]
+
** 37271
* inchi-key:
+
* left-end-position:
** osjppgntcrnqqc-uwtatzphsa-k
+
** 24783
* molecular-weight:
+
* centisome-position:
** 183.034
+
** 6.1753097   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[3PGAREARR-RXN]]
+
* [[S.japonica_sterols_curated]]
* [[PGLYCDEHYDROG-RXN]]
+
== Reaction(s) associated ==
* [[PHOSGLYPHOS-RXN]]
+
* [[GLUCONOKIN-RXN]]
* [[RXN-15511]]
+
** Category: [[annotation]]
* [[RXN-15513]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-17276]]
+
** Category: [[orthology]]
== Reaction(s) known to produce the compound ==
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
* [[3PGAREARR-RXN]]
+
== Pathway(s) associated ==
* [[GLY3KIN-RXN]]
+
* [[PWY-5530]]
* [[PGLYCDEHYDROG-RXN]]
+
** '''2''' reactions found over '''3''' reactions in the full pathway
* [[PHOSGLYPHOS-RXN]]
+
* [[IDNCAT-PWY]]
* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
+
** '''2''' reactions found over '''3''' reactions in the full pathway
* [[RXN-15511]]
+
* [[GLUCONSUPER-PWY]]
* [[RXN-15513]]
+
** '''1''' reactions found over '''1''' reactions in the full pathway
* [[RXN-17274]]
+
{{#set: transcription-direction=positive}}
* [[RXN-3443]]
+
{{#set: right-end-position=37271}}
== Reaction(s) of unknown directionality ==
+
{{#set: left-end-position=24783}}
{{#set: common-name=3-phospho-d-glycerate}}
+
{{#set: centisome-position=6.1753097    }}
{{#set: inchi-key=inchikey=osjppgntcrnqqc-uwtatzphsa-k}}
+
{{#set: organism associated=S.japonica_sterols_curated}}
{{#set: molecular-weight=183.034}}
+
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=3}}

Revision as of 20:21, 18 December 2020

Gene SJ14827

  • transcription-direction:
    • positive
  • right-end-position:
    • 37271
  • left-end-position:
    • 24783
  • centisome-position:
    • 6.1753097

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5530
    • 2 reactions found over 3 reactions in the full pathway
  • IDNCAT-PWY
    • 2 reactions found over 3 reactions in the full pathway
  • GLUCONSUPER-PWY
    • 1 reactions found over 1 reactions in the full pathway