Difference between revisions of "SJ02434"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9866 CPD-9866] == * common-name: ** 2-methoxy-6-(all-trans-nonaprenyl)phenol * smiles: ** c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HEME_C HEME_C] == * common-name: ** heme c == Reaction(s) known to consume the compound == * ...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9866 CPD-9866] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HEME_C HEME_C] ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-(all-trans-nonaprenyl)phenol
+
** heme c
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
** xryxraoxvpwhhk-ssrazkmssa-n
 
* molecular-weight:
 
** 737.203
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9240]]
+
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-(all-trans-nonaprenyl)phenol}}
+
{{#set: common-name=heme c}}
{{#set: inchi-key=inchikey=xryxraoxvpwhhk-ssrazkmssa-n}}
 
{{#set: molecular-weight=737.203}}
 

Revision as of 14:20, 26 August 2019

Metabolite HEME_C

  • common-name:
    • heme c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality