Difference between revisions of "SJ02434"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HEME_C HEME_C] == * common-name: ** heme c == Reaction(s) known to consume the compound == * ...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18666 CPD-18666] == * common-name: ** epoxypheophorbide a * smiles: ** ccc1(=c(c)c3(=nc1=cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18666 CPD-18666] == |
* common-name: | * common-name: | ||
| − | ** | + | ** epoxypheophorbide a |
| + | * smiles: | ||
| + | ** ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)c=c5(c(c)=c(c=c)c4(oc34)(n5))))c(n6)=7)))) | ||
| + | * inchi-key: | ||
| + | ** zmtpzdvbgynplz-ygowezgdsa-m | ||
| + | * molecular-weight: | ||
| + | ** 606.677 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17252]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=epoxypheophorbide a}} |
| + | {{#set: inchi-key=inchikey=zmtpzdvbgynplz-ygowezgdsa-m}} | ||
| + | {{#set: molecular-weight=606.677}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-18666
- common-name:
- epoxypheophorbide a
- smiles:
- ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)c=c5(c(c)=c(c=c)c4(oc34)(n5))))c(n6)=7))))
- inchi-key:
- zmtpzdvbgynplz-ygowezgdsa-m
- molecular-weight:
- 606.677
