Difference between revisions of "SJ02472"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE] == * common-name...")
(Created page with "Category:gene == Gene SJ02472 == * transcription-direction: ** positive * right-end-position: ** 119427 * left-end-position: ** 111931 * centisome-position: ** 82.96286...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE] ==
+
== Gene SJ02472 ==
−
* common-name:
+
* transcription-direction:
−
** β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine
+
** positive
−
* smiles:
+
* right-end-position:
−
** cc(=o)nc2(c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))c(o)2)
+
** 119427
−
* inchi-key:
+
* left-end-position:
−
** kfeujdwyngmdbv-rphkzzmbsa-n
+
** 111931
−
* molecular-weight:
+
* centisome-position:
−
** 383.352
+
** 82.96286   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-15268]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
+
* [[PROTEIN-KINASE-RXN]]
−
* [[RXN-15268]]
+
** Category: [[annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: common-name=β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine}}
+
** Category: [[orthology]]
−
{{#set: inchi-key=inchikey=kfeujdwyngmdbv-rphkzzmbsa-n}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
{{#set: molecular-weight=383.352}}
+
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=119427}}
 +
{{#set: left-end-position=111931}}
 +
{{#set: centisome-position=82.96286    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:01, 18 March 2021

Gene SJ02472

  • transcription-direction:
    • positive
  • right-end-position:
    • 119427
  • left-end-position:
    • 111931
  • centisome-position:
    • 82.96286

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ02472&oldid=132072"