Difference between revisions of "SJ02472"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE] == * common-name...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] == * common-name: ** 4-hydroxy-2-nonenal-glutathione conjugate * smiles: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] ==
 
* common-name:
 
* common-name:
** β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine
+
** 4-hydroxy-2-nonenal-glutathione conjugate
 
* smiles:
 
* smiles:
** cc(=o)nc2(c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))c(o)2)
+
** cccccc(o)c(c[ch]=o)scc(nc(=o)ccc([n+])c(=o)[o-])c(=o)ncc([o-])=o
 
* inchi-key:
 
* inchi-key:
** kfeujdwyngmdbv-rphkzzmbsa-n
+
** nokrnjlendlskm-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 383.352
+
** 462.537
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15268]]
+
* [[RXN-13675]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
+
* [[RXN-13673]]
* [[RXN-15268]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine}}
+
{{#set: common-name=4-hydroxy-2-nonenal-glutathione conjugate}}
{{#set: inchi-key=inchikey=kfeujdwyngmdbv-rphkzzmbsa-n}}
+
{{#set: inchi-key=inchikey=nokrnjlendlskm-uhfffaoysa-m}}
{{#set: molecular-weight=383.352}}
+
{{#set: molecular-weight=462.537}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-14704

  • common-name:
    • 4-hydroxy-2-nonenal-glutathione conjugate
  • smiles:
    • cccccc(o)c(c[ch]=o)scc(nc(=o)ccc([n+])c(=o)[o-])c(=o)ncc([o-])=o
  • inchi-key:
    • nokrnjlendlskm-uhfffaoysa-m
  • molecular-weight:
    • 462.537

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality