Difference between revisions of "SJ02485"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17385 CPD-17385] == * common-name: ** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smil...")
(Created page with "Category:gene == Gene SJ02485 == * transcription-direction: ** negative * right-end-position: ** 127667 * left-end-position: ** 124147 * centisome-position: ** 92.21552...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17385 CPD-17385] ==
+
== Gene SJ02485 ==
* common-name:
+
* transcription-direction:
** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
+
** negative
* smiles:
+
* right-end-position:
** ccc=ccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** 127667
* inchi-key:
+
* left-end-position:
** krifzirxaaithr-kwfbmmabsa-j
+
** 124147
* molecular-weight:
+
* centisome-position:
** 1102.034
+
** 92.21552   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-16134]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-16132]]
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=krifzirxaaithr-kwfbmmabsa-j}}
+
{{#set: transcription-direction=negative}}
{{#set: molecular-weight=1102.034}}
+
{{#set: right-end-position=127667}}
 +
{{#set: left-end-position=124147}}
 +
{{#set: centisome-position=92.21552    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:01, 18 March 2021

Gene SJ02485

  • transcription-direction:
    • negative
  • right-end-position:
    • 127667
  • left-end-position:
    • 124147
  • centisome-position:
    • 92.21552

Organism(s) associated with this gene

Reaction(s) associated