Difference between revisions of "SJ02485"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17385 CPD-17385] == * common-name: ** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smil...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] == * common-name: ** l-dehydro-ascorbate * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17385 CPD-17385] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] ==
 
* common-name:
 
* common-name:
** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
+
** l-dehydro-ascorbate
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c(o)c(o)c1(c(=o)c(=o)c(=o)o1)
 
* inchi-key:
 
* inchi-key:
** krifzirxaaithr-kwfbmmabsa-j
+
** sbjkkffyizucet-szscbosdsa-n
 
* molecular-weight:
 
* molecular-weight:
** 1102.034
+
** 174.11
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16134]]
+
* [[1.8.5.1-RXN]]
 +
* [[RXN-13185]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16132]]
+
* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
 +
* [[ETHYL-RXN]]
 +
* [[RXN-12440]]
 +
* [[RXN-13185]]
 +
* [[RXN-19200]]
 +
* [[RXN-7984]]
 +
* [[RXN-7985]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=l-dehydro-ascorbate}}
{{#set: inchi-key=inchikey=krifzirxaaithr-kwfbmmabsa-j}}
+
{{#set: inchi-key=inchikey=sbjkkffyizucet-szscbosdsa-n}}
{{#set: molecular-weight=1102.034}}
+
{{#set: molecular-weight=174.11}}

Revision as of 09:23, 27 August 2019

Metabolite L-DEHYDRO-ASCORBATE

  • common-name:
    • l-dehydro-ascorbate
  • smiles:
    • c(o)c(o)c1(c(=o)c(=o)c(=o)o1)
  • inchi-key:
    • sbjkkffyizucet-szscbosdsa-n
  • molecular-weight:
    • 174.11

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality