Difference between revisions of "SJ02523"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Gamma-linolenoyl-groups Gamma-linolenoyl-groups] == * common-name: ** a [glycerolipid]-γ-...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17540 CPD-17540] == * common-name: ** dapdiamide b * smiles: ** ccc(c)c(c([o-])=o)nc(c(cnc(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17540 CPD-17540] == |
* common-name: | * common-name: | ||
− | ** | + | ** dapdiamide b |
+ | * smiles: | ||
+ | ** ccc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o | ||
+ | * inchi-key: | ||
+ | ** wsfqksibzodgpb-ofaneystsa-n | ||
+ | * molecular-weight: | ||
+ | ** 314.341 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-16292]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dapdiamide b}} |
+ | {{#set: inchi-key=inchikey=wsfqksibzodgpb-ofaneystsa-n}} | ||
+ | {{#set: molecular-weight=314.341}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-17540
- common-name:
- dapdiamide b
- smiles:
- ccc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
- inchi-key:
- wsfqksibzodgpb-ofaneystsa-n
- molecular-weight:
- 314.341