Difference between revisions of "SJ02529"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARACHIDONIC_ACID ARACHIDONIC_ACID] == * common-name: ** arachidonate * smiles: ** cccccc=ccc=cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Carboxyadenylated-MPT-synthases Carboxyadenylated-MPT-synthases] == * common-name: ** a carboxy...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARACHIDONIC_ACID ARACHIDONIC_ACID] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Carboxyadenylated-MPT-synthases Carboxyadenylated-MPT-synthases] ==
 
* common-name:
 
* common-name:
** arachidonate
+
** a carboxy-adenylated [small subunit of molybdopterin synthase]
* smiles:
 
** cccccc=ccc=ccc=ccc=ccccc(=o)[o-]
 
* inchi-key:
 
** yzxbapsdxzzrgb-dofzraljsa-m
 
* molecular-weight:
 
** 303.464
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARACHIDONATE-15-LIPOXYGENASE-RXN]]
+
* [[RXN-12473]]
* [[ARACHIDONATE-5-LIPOXYGENASE-RXN]]
 
* [[RXN-13395]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16016]]
+
* [[RXN-11361]]
* [[RXN6666-2]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=arachidonate}}
+
{{#set: common-name=a carboxy-adenylated [small subunit of molybdopterin synthase]}}
{{#set: inchi-key=inchikey=yzxbapsdxzzrgb-dofzraljsa-m}}
 
{{#set: molecular-weight=303.464}}
 

Revision as of 09:24, 27 August 2019

Metabolite Carboxyadenylated-MPT-synthases

  • common-name:
    • a carboxy-adenylated [small subunit of molybdopterin synthase]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a carboxy-adenylated [small subunit of molybdopterin synthase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.