Difference between revisions of "SJ02540"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sphingomyelins Sphingomyelins] == * common-name: ** a sphingomyelin == Reaction(s) known to con...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] == * common-name: ** 3-isopropyl-6-(methylthio)-2-oxohexanoate * smiles: *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-isopropyl-6-(methylthio)-2-oxohexanoate |
| + | * smiles: | ||
| + | ** c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** wrgktdwhjsbcjr-uhfffaoysa-l | ||
| + | * molecular-weight: | ||
| + | ** 218.224 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-18208]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-18208]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-isopropyl-6-(methylthio)-2-oxohexanoate}} |
| + | {{#set: inchi-key=inchikey=wrgktdwhjsbcjr-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=218.224}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-19491
- common-name:
- 3-isopropyl-6-(methylthio)-2-oxohexanoate
- smiles:
- c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-]
- inchi-key:
- wrgktdwhjsbcjr-uhfffaoysa-l
- molecular-weight:
- 218.224
