Difference between revisions of "SJ02540"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] == * common-name: ** 3-isopropyl-6-(methylthio)-2-oxohexanoate * smiles: *...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Oxosteroids 3-Oxosteroids] == * common-name: ** a 3-oxosteroid == Reaction(s) known to consum...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Oxosteroids 3-Oxosteroids] ==
 
* common-name:
 
* common-name:
** 3-isopropyl-6-(methylthio)-2-oxohexanoate
+
** a 3-oxosteroid
* smiles:
 
** c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-]
 
* inchi-key:
 
** wrgktdwhjsbcjr-uhfffaoysa-l
 
* molecular-weight:
 
** 218.224
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18208]]
+
* [[RXN-13686]]
 +
* [[RXN-13926]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18208]]
+
* [[RXN-13686]]
 +
* [[RXN-13926]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-isopropyl-6-(methylthio)-2-oxohexanoate}}
+
{{#set: common-name=a 3-oxosteroid}}
{{#set: inchi-key=inchikey=wrgktdwhjsbcjr-uhfffaoysa-l}}
 
{{#set: molecular-weight=218.224}}
 

Revision as of 09:24, 27 August 2019

Metabolite 3-Oxosteroids

  • common-name:
    • a 3-oxosteroid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality