Difference between revisions of "SJ02559"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-pseudouridine1915 23S-rRNA-pseudouridine1915] == * common-name: ** a pseudouridine1915...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9924 CPD-9924] == * common-name: ** 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-car...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9924 CPD-9924] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate |
| + | * smiles: | ||
| + | ** c=c(c(=o)[o-])oc1(cc=c(c(=o)ccc(=o)[o-])c(c(o)1)c(=o)[o-]) | ||
| + | * inchi-key: | ||
| + | ** jkjglrglomrxfn-mvwjerbfsa-k | ||
| + | * molecular-weight: | ||
| + | ** 325.251 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.5.1.64-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate}} |
| + | {{#set: inchi-key=inchikey=jkjglrglomrxfn-mvwjerbfsa-k}} | ||
| + | {{#set: molecular-weight=325.251}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-9924
- common-name:
- 2-succinyl-5-enolpyruvoyl-6-hydroxy-3-cyclohexene-1-carboxylate
- smiles:
- c=c(c(=o)[o-])oc1(cc=c(c(=o)ccc(=o)[o-])c(c(o)1)c(=o)[o-])
- inchi-key:
- jkjglrglomrxfn-mvwjerbfsa-k
- molecular-weight:
- 325.251
