Difference between revisions of "SJ02566"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THYROXINE L-THYROXINE] == * common-name: ** l-thyroxine * smiles: ** c(=o)([o-])c([n+])cc1(c=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-471 CPD-471] == * common-name: ** (r)-3-amino-2-methylpropanoate * smiles: ** cc(c[n+])c([o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THYROXINE L-THYROXINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-471 CPD-471] ==
 
* common-name:
 
* common-name:
** l-thyroxine
+
** (r)-3-amino-2-methylpropanoate
 
* smiles:
 
* smiles:
** c(=o)([o-])c([n+])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2))
+
** cc(c[n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** xuiikfgfijcvmt-lbprgkrzsa-n
+
** qchpksfmdhpsnr-gsvougtgsa-n
 
* molecular-weight:
 
* molecular-weight:
** 776.874
+
** 103.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10606]]
 
* [[RXN-10608]]
 
* [[RXN-10614]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11210]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-thyroxine}}
+
{{#set: common-name=(r)-3-amino-2-methylpropanoate}}
{{#set: inchi-key=inchikey=xuiikfgfijcvmt-lbprgkrzsa-n}}
+
{{#set: inchi-key=inchikey=qchpksfmdhpsnr-gsvougtgsa-n}}
{{#set: molecular-weight=776.874}}
+
{{#set: molecular-weight=103.121}}

Revision as of 09:25, 27 August 2019

Metabolite CPD-471

  • common-name:
    • (r)-3-amino-2-methylpropanoate
  • smiles:
    • cc(c[n+])c([o-])=o
  • inchi-key:
    • qchpksfmdhpsnr-gsvougtgsa-n
  • molecular-weight:
    • 103.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality