Difference between revisions of "SJ02574"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Delta7-Steroids Delta7-Steroids] == * common-name: ** a δ7-sterol == Reaction(s) known to...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7598 CPD-7598] == * common-name: ** anandamide * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)ncc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7598 CPD-7598] == |
* common-name: | * common-name: | ||
| − | ** | + | ** anandamide |
| + | * smiles: | ||
| + | ** cccccc=ccc=ccc=ccc=ccccc(=o)ncco | ||
| + | * inchi-key: | ||
| + | ** lgeqqwmqcriykg-dofzraljsa-n | ||
| + | * molecular-weight: | ||
| + | ** 347.54 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN6666-2]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=anandamide}} |
| + | {{#set: inchi-key=inchikey=lgeqqwmqcriykg-dofzraljsa-n}} | ||
| + | {{#set: molecular-weight=347.54}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-7598
- common-name:
- anandamide
- smiles:
- cccccc=ccc=ccc=ccc=ccccc(=o)ncco
- inchi-key:
- lgeqqwmqcriykg-dofzraljsa-n
- molecular-weight:
- 347.54
