Difference between revisions of "SJ02574"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7598 CPD-7598] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CITRULLINE L-CITRULLINE] ==
 * common-name:
-** anandamide
+** l-citrulline
 * smiles:
-** cccccc=ccc=ccc=ccc=ccccc(=o)ncco
+** c(nc(n)=o)ccc([n+])c(=o)[o-]
 * inchi-key:
-** lgeqqwmqcriykg-dofzraljsa-n
+** rhgklrlohdjjdr-bypyzucnsa-n
 * molecular-weight:
-** 347.54
+** 175.187
 == Reaction(s) known to consume the compound ==
-* [[RXN6666-2]]
+* [[ARGSUCCINSYN-RXN]]
+* [[ORNCARBAMTRANSFER-RXN]]
+* [[RXN-13482]]
 == Reaction(s) known to produce the compound ==
+* [[DIMETHYLARGININASE-RXN]]
+* [[NITRIC-OXIDE-SYNTHASE-RXN]]
+* [[ORNCARBAMTRANSFER-RXN]]
+* [[RXN-13482]]
+* [[RXN-13565]]
+* [[RXN-7933]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=anandamide}}
+{{#set: common-name=l-citrulline}}
-{{#set: inchi-key=inchikey=lgeqqwmqcriykg-dofzraljsa-n}}
+{{#set: inchi-key=inchikey=rhgklrlohdjjdr-bypyzucnsa-n}}
-{{#set: molecular-weight=347.54}}
+{{#set: molecular-weight=175.187}}