Difference between revisions of "SJ02643"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-ACETONE-PHOSPHATE DIHYDROXY-ACETONE-PHOSPHATE] == * common-name: ** glycerone phospha...")
(Created page with "Category:gene == Gene SJ02643 == * transcription-direction: ** negative * right-end-position: ** 131768 * left-end-position: ** 117256 * centisome-position: ** 21.921352...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-ACETONE-PHOSPHATE DIHYDROXY-ACETONE-PHOSPHATE] ==
+
== Gene SJ02643 ==
−
* common-name:
+
* transcription-direction:
−
** glycerone phosphate
+
** negative
−
* smiles:
+
* right-end-position:
−
** c(c(=o)co)op([o-])([o-])=o
+
** 131768
−
* inchi-key:
+
* left-end-position:
−
** gngacratggdkbx-uhfffaoysa-l
+
** 117256
−
* molecular-weight:
+
* centisome-position:
−
** 168.043
+
** 21.921352   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[1.1.1.8-RXN]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[2.3.1.42-RXN]]
+
== Reaction(s) associated ==
−
* [[F16ALDOLASE-RXN]]
+
* [[ATPASE-RXN]]
−
* [[FBA_]]
+
** Category: [[annotation]]
−
* [[G3PD2]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
+
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
−
* [[QUINOLINATE-SYNTHA-RXN]]
+
** Category: [[annotation]]
−
* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-15044]]
+
* [[RXN-11109]]
−
* [[SEDOBISALDOL-RXN]]
+
** Category: [[annotation]]
−
* [[TRIOSEPISOMERIZATION-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-12195]]
−
* [[F16ALDOLASE-RXN]]
+
** Category: [[annotation]]
−
* [[FBA_]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[G3PD2]]
+
* [[RXN-12196]]
−
* [[GLYCEROL-3-PHOSPHATE-OXIDASE-RXN]]
+
** Category: [[annotation]]
−
* [[GLYCERONE-KINASE-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-15740]]
+
* [[RXN0-5462]]
−
* [[RXN-15745]]
+
** Category: [[annotation]]
−
* [[RXN-8631]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN0-5260]]
+
== Pathway(s) associated ==
−
* [[SEDOBISALDOL-RXN]]
+
* [[PWY-6545]]
−
* [[TAGAALDOL-RXN]]
+
** '''8''' reactions found over '''9''' reactions in the full pathway
−
* [[TRIOSEPISOMERIZATION-RXN]]
+
* [[PWY-7210]]
−
== Reaction(s) of unknown directionality ==
+
** '''8''' reactions found over '''8''' reactions in the full pathway
−
{{#set: common-name=glycerone phosphate}}
+
* [[PWY-7198]]
−
{{#set: inchi-key=inchikey=gngacratggdkbx-uhfffaoysa-l}}
+
** '''6''' reactions found over '''7''' reactions in the full pathway
−
{{#set: molecular-weight=168.043}}
+
* [[PWY-7184]]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=131768}}
 +
{{#set: left-end-position=117256}}
 +
{{#set: centisome-position=21.921352    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=6}}
 +
{{#set: nb pathway associated=4}}

Latest revision as of 11:00, 18 March 2021

Gene SJ02643

  • transcription-direction:
    • negative
  • right-end-position:
    • 131768
  • left-end-position:
    • 117256
  • centisome-position:
    • 21.921352

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6545
    • 8 reactions found over 9 reactions in the full pathway
  • PWY-7210
    • 8 reactions found over 8 reactions in the full pathway
  • PWY-7198
    • 6 reactions found over 7 reactions in the full pathway
  • PWY-7184
    • 9 reactions found over 9 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ02643&oldid=131610"