Difference between revisions of "SJ02694"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7257 CPD-7257] == * common-name: ** 3α,7α,12α-trihydroxy-24-oxo-5-β-...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINAMIDE_RIBOSE NICOTINAMIDE_RIBOSE] == * common-name: ** 1-(β-d ribofuranosyl)nicotin...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINAMIDE_RIBOSE NICOTINAMIDE_RIBOSE] == |
* common-name: | * common-name: | ||
− | ** | + | ** 1-(β-d ribofuranosyl)nicotinamide |
* smiles: | * smiles: | ||
− | ** | + | ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** jlebzpbdrkpwtd-turqnecasa-o |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 255.25 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-5841]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1-(β-d ribofuranosyl)nicotinamide}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jlebzpbdrkpwtd-turqnecasa-o}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=255.25}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite NICOTINAMIDE_RIBOSE
- common-name:
- 1-(β-d ribofuranosyl)nicotinamide
- smiles:
- c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2))
- inchi-key:
- jlebzpbdrkpwtd-turqnecasa-o
- molecular-weight:
- 255.25