Difference between revisions of "SJ02706"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETOACETYL-COA ACETOACETYL-COA] == * common-name: ** acetoacetyl-coa * smiles: ** cc(=o)cc(=o)...")
(Created page with "Category:gene == Gene SJ02706 == * transcription-direction: ** negative * right-end-position: ** 26336 * left-end-position: ** 8295 * centisome-position: ** 1.5524377...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETOACETYL-COA ACETOACETYL-COA] ==
+
== Gene SJ02706 ==
* common-name:
+
* transcription-direction:
** acetoacetyl-coa
+
** negative
* smiles:
+
* right-end-position:
** cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 26336
* inchi-key:
+
* left-end-position:
** ojfdkhtzouzbos-citakdkdsa-j
+
** 8295
* molecular-weight:
+
* centisome-position:
** 847.577
+
** 1.5524377   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[ACACT1h]]
+
== Reaction(s) associated ==
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
+
* [[5.3.4.1-RXN]]
* [[HACD1h]]
+
** Category: [[annotation]]
* [[HBCO_LPAREN_nadp_RPAREN_]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[HBCO_LPAREN_nadp_RPAREN_m]]
+
* [[DISULISOM-RXN]]
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
+
** Category: [[annotation]]
* [[RXN-11662]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-5901]]
+
{{#set: transcription-direction=negative}}
== Reaction(s) known to produce the compound ==
+
{{#set: right-end-position=26336}}
* [[ACACT]]
+
{{#set: left-end-position=8295}}
* [[ACACT1h]]
+
{{#set: centisome-position=1.5524377    }}
* [[ACETOACETATE--COA-LIGASE-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
+
{{#set: nb reaction associated=2}}
* [[HACD1h]]
 
* [[HBCO]]
 
* [[HBCO_LPAREN_nadp_RPAREN_]]
 
* [[HBCO_LPAREN_nadp_RPAREN_m]]
 
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 
* [[RXN-11662]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=acetoacetyl-coa}}
 
{{#set: inchi-key=inchikey=ojfdkhtzouzbos-citakdkdsa-j}}
 
{{#set: molecular-weight=847.577}}
 

Latest revision as of 11:01, 18 March 2021

Gene SJ02706

  • transcription-direction:
    • negative
  • right-end-position:
    • 26336
  • left-end-position:
    • 8295
  • centisome-position:
    • 1.5524377

Organism(s) associated with this gene

Reaction(s) associated