Difference between revisions of "SJ02712"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINONONANOATE DIAMINONONANOATE] == * common-name: ** 7,8-diaminopelargonate * smiles: ** cc(...")
(Created page with "Category:gene == Gene SJ02712 == * transcription-direction: ** positive * right-end-position: ** 222393 * left-end-position: ** 220523 * centisome-position: ** 41.271633...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINONONANOATE DIAMINONONANOATE] ==
+
== Gene SJ02712 ==
* common-name:
+
* transcription-direction:
** 7,8-diaminopelargonate
+
** positive
* smiles:
+
* right-end-position:
** cc(c(cccccc([o-])=o)[n+])[n+]
+
** 222393
* inchi-key:
+
* left-end-position:
** kcegbpiygiwcdh-uhfffaoysa-o
+
** 220523
* molecular-weight:
+
* centisome-position:
** 189.277
+
** 41.271633   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[DAPASYN-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[DETHIOBIOTIN-SYN-RXN]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
* [[DAPASYN-RXN]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=7,8-diaminopelargonate}}
+
== Pathway(s) associated ==
{{#set: inchi-key=inchikey=kcegbpiygiwcdh-uhfffaoysa-o}}
+
* [[PWY-7511]]
{{#set: molecular-weight=189.277}}
+
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=222393}}
 +
{{#set: left-end-position=220523}}
 +
{{#set: centisome-position=41.271633    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:01, 18 March 2021

Gene SJ02712

  • transcription-direction:
    • positive
  • right-end-position:
    • 222393
  • left-end-position:
    • 220523
  • centisome-position:
    • 41.271633

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway