Difference between revisions of "SJ02714"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] == * common-name: ** (r)-mevalonate 5-phosphate * smiles: ** cc(o)(ccop(=o)([o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMMONIA AMMONIA] == * common-name: ** ammonia * smiles: ** [nh3] * inchi-key: ** qgzkdvfqnngyky...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMMONIA AMMONIA] ==
 
* common-name:
 
* common-name:
** (r)-mevalonate 5-phosphate
+
** ammonia
 
* smiles:
 
* smiles:
** cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-]
+
** [nh3]
 
* inchi-key:
 
* inchi-key:
** okzycxhttzzysk-zcfiwibfsa-k
+
** qgzkdvfqnngyky-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 225.115
+
** 17.03
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MEVALONATE-KINASE-RXN]]
+
* [[ExchangeSeed-AMMONIA]]
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
+
* [[TransportSeed-AMMONIA]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MEVALONATE-KINASE-RXN]]
+
* [[ExchangeSeed-AMMONIA]]
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
+
* [[RXN-17130]]
 +
* [[TransportSeed-AMMONIA]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-mevalonate 5-phosphate}}
+
{{#set: common-name=ammonia}}
{{#set: inchi-key=inchikey=okzycxhttzzysk-zcfiwibfsa-k}}
+
{{#set: inchi-key=inchikey=qgzkdvfqnngyky-uhfffaoysa-n}}
{{#set: molecular-weight=225.115}}
+
{{#set: molecular-weight=17.03}}

Revision as of 09:24, 27 August 2019

Metabolite AMMONIA

  • common-name:
    • ammonia
  • smiles:
    • [nh3]
  • inchi-key:
    • qgzkdvfqnngyky-uhfffaoysa-n
  • molecular-weight:
    • 17.03

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality