Difference between revisions of "SJ02722"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cytidine-34-tRNAIle2 Cytidine-34-tRNAIle2] == * common-name: ** a cytidine34 in trnaile2 == Rea...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] == * common-name: ** (2e,11z)-hexadec-2,11-dienoyl-coa * smiles: ** ccccc=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cytidine-34-tRNAIle2 Cytidine-34-tRNAIle2] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] ==
 
* common-name:
 
* common-name:
** a cytidine34 in trnaile2
+
** (2e,11z)-hexadec-2,11-dienoyl-coa
 +
* smiles:
 +
** ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 +
* inchi-key:
 +
** amssmxhtrodksm-fyyfncousa-j
 +
* molecular-weight:
 +
** 997.883
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1961]]
+
* [[RXN-16558]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a cytidine34 in trnaile2}}
+
{{#set: common-name=(2e,11z)-hexadec-2,11-dienoyl-coa}}
 +
{{#set: inchi-key=inchikey=amssmxhtrodksm-fyyfncousa-j}}
 +
{{#set: molecular-weight=997.883}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-17813

  • common-name:
    • (2e,11z)-hexadec-2,11-dienoyl-coa
  • smiles:
    • ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • amssmxhtrodksm-fyyfncousa-j
  • molecular-weight:
    • 997.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality