Difference between revisions of "SJ02725"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15686 CPD-15686] == * common-name: ** (3r)-hydroxy- 5-cis, 7-trans-tetradecadienoyl-coa * s...")
 
(Created page with "Category:gene == Gene SJ05219 == * transcription-direction: ** positive * right-end-position: ** 92228 * left-end-position: ** 77297 * centisome-position: ** 81.13978...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15686 CPD-15686] ==
+
== Gene SJ05219 ==
−
* common-name:
+
* transcription-direction:
−
** (3r)-hydroxy- 5-cis, 7-trans-tetradecadienoyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** ccccccc=cc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 92228
−
* inchi-key:
+
* left-end-position:
−
** zzvzpdqtnsjqpz-voxmgfccsa-j
+
** 77297
−
* molecular-weight:
+
* centisome-position:
−
** 985.829
+
** 81.13978   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
−
* [[RXN-14797]]
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-11190]]
−
{{#set: common-name=(3r)-hydroxy- 5-cis, 7-trans-tetradecadienoyl-coa}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=zzvzpdqtnsjqpz-voxmgfccsa-j}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=985.829}}
+
* [[SPERMIDINESYN-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[SPERMINE-SYNTHASE-RXN]]
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[BSUBPOLYAMSYN-PWY]]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
* [[POLYAMINSYN3-PWY]]
 +
** '''4''' reactions found over '''1''' reactions in the full pathway
 +
* [[ARGSPECAT-PWY]]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=92228}}
 +
{{#set: left-end-position=77297}}
 +
{{#set: centisome-position=81.13978    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}
 +
{{#set: nb pathway associated=3}}

Revision as of 14:20, 26 August 2019

Gene SJ05219

  • transcription-direction:
    • positive
  • right-end-position:
    • 92228
  • left-end-position:
    • 77297
  • centisome-position:
    • 81.13978

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ02725&oldid=16211"