Difference between revisions of "SJ02725"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05219 == * transcription-direction: ** positive * right-end-position: ** 92228 * left-end-position: ** 77297 * centisome-position: ** 81.13978...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1107 CPD-1107] == * common-name: ** d-myo-inositol 1,3,4,5,6-pentakisphosphate * smiles: **...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ05219 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1107 CPD-1107] ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** d-myo-inositol 1,3,4,5,6-pentakisphosphate
−
* right-end-position:
+
* smiles:
−
** 92228
+
** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
−
* left-end-position:
+
* inchi-key:
−
** 77297
+
** ctpqaxvnygzuaj-kxxvrosksa-d
−
* centisome-position:
+
* molecular-weight:
−
** 81.13978   
+
** 569.977
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10963]]
−
== Reaction(s) associated ==
+
* [[RXN-13197]]
−
* [[RXN-11190]]
+
* [[RXN-7163]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[2.7.1.134-RXN]]
−
* [[SPERMIDINESYN-RXN]]
+
* [[2.7.1.140-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-10963]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-13197]]
−
** Category: [[orthology]]
+
* [[RXN-7162]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-7184]]
−
* [[SPERMINE-SYNTHASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=d-myo-inositol 1,3,4,5,6-pentakisphosphate}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-kxxvrosksa-d}}
−
== Pathway(s) associated ==
+
{{#set: molecular-weight=569.977}}
−
* [[BSUBPOLYAMSYN-PWY]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[POLYAMINSYN3-PWY]]
 
−
** '''4''' reactions found over '''1''' reactions in the full pathway
 
−
* [[ARGSPECAT-PWY]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=92228}}
 
−
{{#set: left-end-position=77297}}
 
−
{{#set: centisome-position=81.13978    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=3}}
 

Revision as of 09:25, 27 August 2019

Metabolite CPD-1107

  • common-name:
    • d-myo-inositol 1,3,4,5,6-pentakisphosphate
  • smiles:
    • c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
  • inchi-key:
    • ctpqaxvnygzuaj-kxxvrosksa-d
  • molecular-weight:
    • 569.977

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ02725&oldid=29224"