Difference between revisions of "SJ02769"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15125 CPD-15125] == * common-name: ** 2,4-dihydroxyhept-2-enedioate * smiles: ** c(=o)([o-]...")
(Created page with "Category:gene == Gene SJ18952 == * transcription-direction: ** negative * right-end-position: ** 181715 * left-end-position: ** 158927 * centisome-position: ** 24.81323...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15125 CPD-15125] ==
+
== Gene SJ18952 ==
* common-name:
+
* transcription-direction:
** 2,4-dihydroxyhept-2-enedioate
+
** negative
* smiles:
+
* right-end-position:
** c(=o)([o-])ccc(o)c=c(o)c(=o)[o-]
+
** 181715
* inchi-key:
+
* left-end-position:
** apnidhdqyiszae-hyxafxhysa-l
+
** 158927
* molecular-weight:
+
* centisome-position:
** 188.137
+
** 24.81323   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-14146]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-14146]]
+
* [[PROTEIN-KINASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=2,4-dihydroxyhept-2-enedioate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=apnidhdqyiszae-hyxafxhysa-l}}
+
{{#set: transcription-direction=negative}}
{{#set: molecular-weight=188.137}}
+
{{#set: right-end-position=181715}}
 +
{{#set: left-end-position=158927}}
 +
{{#set: centisome-position=24.81323    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:22, 18 December 2020

Gene SJ18952

  • transcription-direction:
    • negative
  • right-end-position:
    • 181715
  • left-end-position:
    • 158927
  • centisome-position:
    • 24.81323

Organism(s) associated with this gene

Reaction(s) associated