Difference between revisions of "SJ02769"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15656 CPD-15656] == * common-name: ** (3e)-undec-2-enoyl-coa * smiles: ** ccccccccc=cc(=o)s...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15125 CPD-15125] == * common-name: ** 2,4-dihydroxyhept-2-enedioate * smiles: ** c(=o)([o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15656 CPD-15656] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15125 CPD-15125] ==
 
* common-name:
 
* common-name:
** (3e)-undec-2-enoyl-coa
+
** 2,4-dihydroxyhept-2-enedioate
 
* smiles:
 
* smiles:
** ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(=o)([o-])ccc(o)c=c(o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** cavmkinpgrcurl-phhhidlgsa-j
+
** apnidhdqyiszae-hyxafxhysa-l
 
* molecular-weight:
 
* molecular-weight:
** 929.765
+
** 188.137
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14778]]
+
* [[RXN-14146]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14146]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3e)-undec-2-enoyl-coa}}
+
{{#set: common-name=2,4-dihydroxyhept-2-enedioate}}
{{#set: inchi-key=inchikey=cavmkinpgrcurl-phhhidlgsa-j}}
+
{{#set: inchi-key=inchikey=apnidhdqyiszae-hyxafxhysa-l}}
{{#set: molecular-weight=929.765}}
+
{{#set: molecular-weight=188.137}}

Revision as of 09:25, 27 August 2019

Metabolite CPD-15125

  • common-name:
    • 2,4-dihydroxyhept-2-enedioate
  • smiles:
    • c(=o)([o-])ccc(o)c=c(o)c(=o)[o-]
  • inchi-key:
    • apnidhdqyiszae-hyxafxhysa-l
  • molecular-weight:
    • 188.137

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality