Difference between revisions of "SJ02782"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18492 CPD-18492] == * common-name: ** (2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa * smile...")
(Created page with "Category:gene == Gene SJ05576 == * transcription-direction: ** positive * right-end-position: ** 507445 * left-end-position: ** 503974 * centisome-position: ** 54.0635...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18492 CPD-18492] ==
+
== Gene SJ05576 ==
* common-name:
+
* transcription-direction:
** (2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa
+
** positive
* smiles:
+
* right-end-position:
** cccccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** 507445
* inchi-key:
+
* left-end-position:
** uyokhwfeuajfmg-uiyhdvlfsa-j
+
** 503974
* molecular-weight:
+
* centisome-position:
** 1102.034
+
** 54.0635   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-17114]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-17113]]
+
* [[3.1.13.4-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=(2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=uyokhwfeuajfmg-uiyhdvlfsa-j}}
+
{{#set: transcription-direction=positive}}
{{#set: molecular-weight=1102.034}}
+
{{#set: right-end-position=507445}}
 +
{{#set: left-end-position=503974}}
 +
{{#set: centisome-position=54.0635    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:19, 18 December 2020

Gene SJ05576

  • transcription-direction:
    • positive
  • right-end-position:
    • 507445
  • left-end-position:
    • 503974
  • centisome-position:
    • 54.0635

Organism(s) associated with this gene

Reaction(s) associated