Difference between revisions of "SJ02870"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] == * common-name: ** (11z)-(s)-3-hydroxyhexadec-11-enoyl-coa * smiles: **...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=General-Protein-Substrates General-Protein-Substrates] == * common-name: ** a protein == Reacti...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=General-Protein-Substrates General-Protein-Substrates] ==
 
* common-name:
 
* common-name:
−
** (11z)-(s)-3-hydroxyhexadec-11-enoyl-coa
+
** a protein
−
* smiles:
 
−
** ccccc=ccccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
 
−
* inchi-key:
 
−
** shgdvnglfxviak-bfvorphasa-j
 
−
* molecular-weight:
 
−
** 1015.898
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-16559]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[3.4.16.6-RXN]]
 +
* [[3.4.18.1-RXN]]
 +
* [[3.4.21.102-RXN]]
 +
* [[3.4.21.112-RXN]]
 +
* [[3.4.21.26-RXN]]
 +
* [[3.4.21.4-RXN]]
 +
* [[3.4.21.53-RXN]]
 +
* [[3.4.21.92-RXN]]
 +
* [[3.4.22.1-RXN]]
 +
* [[3.4.22.15-RXN]]
 +
* [[3.4.22.16-RXN]]
 +
* [[3.4.22.34-RXN]]
 +
* [[3.4.22.41-RXN]]
 +
* [[3.4.23.1-RXN]]
 +
* [[3.4.23.34-RXN]]
 +
* [[3.4.23.5-RXN]]
 +
* [[3.4.24.61-RXN]]
 +
* [[3.4.25.1-RXN]]
 +
* [[3.6.4.7-RXN]]
 +
* [[ARGINYLTRANSFERASE-RXN]]
 +
* [[DISULISOM-RXN]]
 +
* [[RXN-11136]]
 +
* [[RXN0-1061]]
 +
* [[RXN0-5204]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-16558]]
+
* [[3.1.2.22-RXN]]
−
* [[RXN-16559]]
+
* [[3.4.16.6-RXN]]
 +
* [[3.6.4.7-RXN]]
 +
* [[DISULISOM-RXN]]
 +
* [[RXN0-1061]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(11z)-(s)-3-hydroxyhexadec-11-enoyl-coa}}
+
{{#set: common-name=a protein}}
−
{{#set: inchi-key=inchikey=shgdvnglfxviak-bfvorphasa-j}}
 
−
{{#set: molecular-weight=1015.898}}
 

Revision as of 09:23, 27 August 2019

Metabolite General-Protein-Substrates

  • common-name:
    • a protein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ02870&oldid=27444"