Difference between revisions of "SJ02880"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8775 CPD-8775] == * common-name: ** m-toluate * smiles: ** cc1(=cc(=cc=c1)c(=o)[o-]) * inch...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18890 CPD-18890] == * smiles: ** cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)ccc=c(c)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8775 CPD-8775] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18890 CPD-18890] ==
 +
* smiles:
 +
** cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
 
* common-name:
 
* common-name:
** m-toluate
+
** geranylgeranyl bacteriochlorophyllide b
* smiles:
 
** cc1(=cc(=cc=c1)c(=o)[o-])
 
* inchi-key:
 
** gpsduzxpycfosq-uhfffaoysa-m
 
 
* molecular-weight:
 
* molecular-weight:
** 135.142
+
** 902.447
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17481]]
 +
* [[RXN-17483]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8583]]
+
* [[RXN-17480]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=m-toluate}}
+
{{#set: common-name=geranylgeranyl bacteriochlorophyllide b}}
{{#set: inchi-key=inchikey=gpsduzxpycfosq-uhfffaoysa-m}}
+
{{#set: molecular-weight=902.447}}
{{#set: molecular-weight=135.142}}
 

Revision as of 09:23, 27 August 2019

Metabolite CPD-18890

  • smiles:
    • cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
  • common-name:
    • geranylgeranyl bacteriochlorophyllide b
  • molecular-weight:
    • 902.447

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality