Difference between revisions of "SJ02880"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYLCHOLINE ACETYLCHOLINE] == * common-name: ** acetylcholine * smiles: ** cc(=o)occ[n+](c)(c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8775 CPD-8775] == * common-name: ** m-toluate * smiles: ** cc1(=cc(=cc=c1)c(=o)[o-]) * inch...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8775 CPD-8775] == |
* common-name: | * common-name: | ||
| − | ** | + | ** m-toluate |
* smiles: | * smiles: | ||
| − | ** cc(=o) | + | ** cc1(=cc(=cc=c1)c(=o)[o-]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gpsduzxpycfosq-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 135.142 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-8583]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=m-toluate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gpsduzxpycfosq-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=135.142}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-8775
- common-name:
- m-toluate
- smiles:
- cc1(=cc(=cc=c1)c(=o)[o-])
- inchi-key:
- gpsduzxpycfosq-uhfffaoysa-m
- molecular-weight:
- 135.142
