Difference between revisions of "SJ02907"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPIMELOYL-COA 3-OXOPIMELOYL-COA] == * common-name: ** 3-oxopimeloyl-coa * smiles: ** cc(c)(...")
(Created page with "Category:gene == Gene SJ02907 == * transcription-direction: ** negative * right-end-position: ** 171775 * left-end-position: ** 143572 * centisome-position: ** 27.03351...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPIMELOYL-COA 3-OXOPIMELOYL-COA] ==
+
== Gene SJ02907 ==
−
* common-name:
+
* transcription-direction:
−
** 3-oxopimeloyl-coa
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(cccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 171775
−
* inchi-key:
+
* left-end-position:
−
** kjxfofktzdjlmq-uyrkptjqsa-i
+
** 143572
−
* molecular-weight:
+
* centisome-position:
−
** 918.632
+
** 27.03351   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-8032]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-8032]]
+
* [[ALANINE--TRNA-LIGASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=3-oxopimeloyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=kjxfofktzdjlmq-uyrkptjqsa-i}}
+
** Category: [[orthology]]
−
{{#set: molecular-weight=918.632}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[TRNA-CHARGING-PWY]]
 +
** '''21''' reactions found over '''21''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=171775}}
 +
{{#set: left-end-position=143572}}
 +
{{#set: centisome-position=27.03351    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ02907

  • transcription-direction:
    • negative
  • right-end-position:
    • 171775
  • left-end-position:
    • 143572
  • centisome-position:
    • 27.03351

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ02907&oldid=132471"