Difference between revisions of "SJ02953"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-2-hydroxyacids D-2-hydroxyacids] == * common-name: ** an (r)-2-hydroxycarboxylate == Reaction...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19148 CPD-19148] == * common-name: ** (5z)-dodecenoyl-coa * smiles: ** ccccccc=ccccc(=o)scc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-2-hydroxyacids D-2-hydroxyacids] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19148 CPD-19148] ==
 
* common-name:
 
* common-name:
** an (r)-2-hydroxycarboxylate
+
** (5z)-dodecenoyl-coa
 +
* smiles:
 +
** ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** rcvjzgbrlgutkt-cggpsvllsa-j
 +
* molecular-weight:
 +
** 943.792
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.272-RXN]]
+
* [[RXN-17796]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.272-RXN]]
+
* [[RXN-17795]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an (r)-2-hydroxycarboxylate}}
+
{{#set: common-name=(5z)-dodecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=rcvjzgbrlgutkt-cggpsvllsa-j}}
 +
{{#set: molecular-weight=943.792}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-19148

  • common-name:
    • (5z)-dodecenoyl-coa
  • smiles:
    • ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • rcvjzgbrlgutkt-cggpsvllsa-j
  • molecular-weight:
    • 943.792

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality