Difference between revisions of "SJ02966"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-behenoyl-ACPs 3-oxo-behenoyl-ACPs] == * common-name: ** a 3-oxo-behenoyl-[acp] == Reactio...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * common-name: ** 6-hydroxy-2-cyclohexen-one-carboxylate * smiles: ** c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6-hydroxy-2-cyclohexen-one-carboxylate |
| + | * smiles: | ||
| + | ** c(=o)(c1(o)(c=cccc(=o)1))[o-] | ||
| + | * inchi-key: | ||
| + | ** wezwwzkubqcmbl-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 155.13 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12252]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6-hydroxy-2-cyclohexen-one-carboxylate}} |
| + | {{#set: inchi-key=inchikey=wezwwzkubqcmbl-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=155.13}} | ||
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-13172
- common-name:
- 6-hydroxy-2-cyclohexen-one-carboxylate
- smiles:
- c(=o)(c1(o)(c=cccc(=o)1))[o-]
- inchi-key:
- wezwwzkubqcmbl-uhfffaoysa-m
- molecular-weight:
- 155.13
