Difference between revisions of "SJ03015"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] == * common-name: ** dgtp * smiles: ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1...")
(Created page with "Category:gene == Gene SJ18714 == * transcription-direction: ** negative * right-end-position: ** 306736 * left-end-position: ** 264804 * centisome-position: ** 41.15621...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] ==
+
== Gene SJ18714 ==
* common-name:
+
* transcription-direction:
** dgtp
+
** negative
* smiles:
+
* right-end-position:
** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** 306736
* inchi-key:
+
* left-end-position:
** haazlughyhwqiw-kvqbguixsa-j
+
** 264804
* molecular-weight:
+
* centisome-position:
** 503.152
+
** 41.15621   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[DGTCY]]
+
* [[S.japonica_sterols_curated]]
* [[DGTD]]
+
== Reaction(s) associated ==
* [[DGTPTRIPHYDRO-RXN]]
+
* [[PROTEIN-KINASE-RXN]]
* [[DGTPtm]]
+
** Category: [[annotation]]
* [[DGTUP]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-14208]]
+
** Category: [[orthology]]
* [[RXN-14217]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN0-385]]
+
* [[RXN-8443]]
== Reaction(s) known to produce the compound ==
+
** Category: [[orthology]]
* [[ATDGD]]
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
* [[DGDPKIN-RXN]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[DGTPtm]]
+
== Pathway(s) associated ==
* [[RXN-14207]]
+
* [[PWY-5381]]
* [[RXN0-746]]
+
** '''6''' reactions found over '''11''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
{{#set: transcription-direction=negative}}
{{#set: common-name=dgtp}}
+
{{#set: right-end-position=306736}}
{{#set: inchi-key=inchikey=haazlughyhwqiw-kvqbguixsa-j}}
+
{{#set: left-end-position=264804}}
{{#set: molecular-weight=503.152}}
+
{{#set: centisome-position=41.15621    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:20, 18 December 2020

Gene SJ18714

  • transcription-direction:
    • negative
  • right-end-position:
    • 306736
  • left-end-position:
    • 264804
  • centisome-position:
    • 41.15621

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5381
    • 6 reactions found over 11 reactions in the full pathway