Difference between revisions of "SJ03027"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINONONANOATE DIAMINONONANOATE] == * common-name: ** 7,8-diaminopelargonate * smiles: ** cc(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12127 CPD-12127] == * common-name: ** menaquinol-10 * smiles: ** cc(=cccc(=cccc(c)=cccc(c)=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINONONANOATE DIAMINONONANOATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12127 CPD-12127] ==
 
* common-name:
 
* common-name:
** 7,8-diaminopelargonate
+
** menaquinol-10
 
* smiles:
 
* smiles:
** cc(c(cccccc([o-])=o)[n+])[n+]
+
** cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
 
* inchi-key:
 
* inchi-key:
** kcegbpiygiwcdh-uhfffaoysa-o
+
** wlkiromwgyxjma-uqunhumxsa-n
 
* molecular-weight:
 
* molecular-weight:
** 189.277
+
** 855.381
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DAPASYN-RXN]]
 
* [[DETHIOBIOTIN-SYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DAPASYN-RXN]]
+
* [[RXN-9361]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-diaminopelargonate}}
+
{{#set: common-name=menaquinol-10}}
{{#set: inchi-key=inchikey=kcegbpiygiwcdh-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=wlkiromwgyxjma-uqunhumxsa-n}}
{{#set: molecular-weight=189.277}}
+
{{#set: molecular-weight=855.381}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-12127

  • common-name:
    • menaquinol-10
  • smiles:
    • cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
  • inchi-key:
    • wlkiromwgyxjma-uqunhumxsa-n
  • molecular-weight:
    • 855.381

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality