Difference between revisions of "SJ03060"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4209 CPD-4209] == * common-name: ** n6-dimethylallyladenine * smiles: ** cc(c)=ccnc1(=nc=nc...")
 
(Created page with "Category:gene == Gene SJ03060 == * transcription-direction: ** positive * right-end-position: ** 124499 * left-end-position: ** 103889 * centisome-position: ** 19.595154...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4209 CPD-4209] ==
+
== Gene SJ03060 ==
* common-name:
+
* transcription-direction:
** n6-dimethylallyladenine
+
** positive
* smiles:
+
* right-end-position:
** cc(c)=ccnc1(=nc=nc2(nc=nc1=2))
+
** 124499
* inchi-key:
+
* left-end-position:
** hyvabzigrdekcd-uhfffaoysa-n
+
** 103889
* molecular-weight:
+
* centisome-position:
** 203.246
+
** 19.595154   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[1.5.99.12-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-4315]]
+
== Reaction(s) associated ==
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
+
* [[PROTEIN-KINASE-RXN]]
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
+
** Category: [[annotation]]
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[1.5.99.12-RXN]]
+
** Category: [[orthology]]
* [[RXN-4313]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
+
{{#set: transcription-direction=positive}}
* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]]
+
{{#set: right-end-position=124499}}
* [[RXN-4315]]
+
{{#set: left-end-position=103889}}
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
+
{{#set: centisome-position=19.595154    }}
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction associated=1}}
{{#set: common-name=n6-dimethylallyladenine}}
 
{{#set: inchi-key=inchikey=hyvabzigrdekcd-uhfffaoysa-n}}
 
{{#set: molecular-weight=203.246}}
 

Latest revision as of 11:02, 18 March 2021

Gene SJ03060

  • transcription-direction:
    • positive
  • right-end-position:
    • 124499
  • left-end-position:
    • 103889
  • centisome-position:
    • 19.595154

Organism(s) associated with this gene

Reaction(s) associated