Difference between revisions of "SJ03096"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE-ACETOL-P IMIDAZOLE-ACETOL-P] == * common-name: ** imidazole acetol-phosphate * smiles...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Hex-2-enoyl-ACPs Hex-2-enoyl-ACPs] == * common-name: ** a trans hex-2-enoyl-[acp] == Reaction(s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE-ACETOL-P IMIDAZOLE-ACETOL-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Hex-2-enoyl-ACPs Hex-2-enoyl-ACPs] ==
 
* common-name:
 
* common-name:
** imidazole acetol-phosphate
+
** a trans hex-2-enoyl-[acp]
* smiles:
 
** c1(nc=nc=1cc(cop([o-])(=o)[o-])=o)
 
* inchi-key:
 
** ycffmsolumramd-uhfffaoysa-l
 
* molecular-weight:
 
** 218.105
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HISTAMINOTRANS-RXN]]
+
* [[RXN-9521]]
 +
* [[RXN-9658]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HISTAMINOTRANS-RXN]]
+
* [[RXN-9520]]
* [[IGPD]]
 
* [[IMIDPHOSDEHYD-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=imidazole acetol-phosphate}}
+
{{#set: common-name=a trans hex-2-enoyl-[acp]}}
{{#set: inchi-key=inchikey=ycffmsolumramd-uhfffaoysa-l}}
 
{{#set: molecular-weight=218.105}}
 

Revision as of 14:20, 26 August 2019

Metabolite Hex-2-enoyl-ACPs

  • common-name:
    • a trans hex-2-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a trans hex-2-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.