Difference between revisions of "SJ03172"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] == * common-name: ** episterol * smiles: ** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13188 CPD-13188] == * common-name: ** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13188 CPD-13188] == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp |
* smiles: | * smiles: | ||
| − | ** | + | ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)o)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cwvrqjbcbctflt-civpzrojsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 488.442 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12270]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cwvrqjbcbctflt-civpzrojsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=488.442}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-13188
- common-name:
- β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp
- smiles:
- cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)o))
- inchi-key:
- cwvrqjbcbctflt-civpzrojsa-n
- molecular-weight:
- 488.442
