Difference between revisions of "SJ03195"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pre-tRNA-5-prime-half-molecules Pre-tRNA-5-prime-half-molecules] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15424 CPD-15424] ==
 * common-name:
-** a 5'-half-trna molecule with a 2',3'-cyclic phosphate end
+** o-carbamoyladenylate
+* smiles:
+** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)n)([o-])=o
+* inchi-key:
+** chsnpofvfypelh-kqynxxcusa-m
+* molecular-weight:
+** 389.241
 == Reaction(s) known to consume the compound ==
+* [[RXN-13167]]
+* [[RXN-13168]]
+* [[RXN-14553]]
 == Reaction(s) known to produce the compound ==
-* [[3.1.27.9-RXN]]
+* [[RXN-14552]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=a 5'-half-trna molecule with a 2',3'-cyclic phosphate end}}
+{{#set: common-name=o-carbamoyladenylate}}
+{{#set: inchi-key=inchikey=chsnpofvfypelh-kqynxxcusa-m}}
+{{#set: molecular-weight=389.241}}