Difference between revisions of "SJ03217"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] == * common-name: ** sn-glycerol 3-phosphate * smiles: ** c(op([o-])(=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == * common-name: ** queuine * smiles: ** c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** queuine |
* smiles: | * smiles: | ||
| − | ** c | + | ** c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(nc(=o)c2=3)n)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wyrolenthwjflr-acldmzeesa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 278.29 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=queuine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wyrolenthwjflr-acldmzeesa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=278.29}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite QUEUINE
- common-name:
- queuine
- smiles:
- c([n+]c1(c=cc(o)c(o)1))c2(=cnc3(n=c(nc(=o)c2=3)n))
- inchi-key:
- wyrolenthwjflr-acldmzeesa-o
- molecular-weight:
- 278.29
