Difference between revisions of "SJ03227"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2354 CPD0-2354] == * common-name: ** a trna precursor with a 5' extension == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE GUANOSINE] == * common-name: ** guanosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE GUANOSINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** guanosine |
| + | * smiles: | ||
| + | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) | ||
| + | * inchi-key: | ||
| + | ** nyhbqmygnkiuif-uuokfmhzsa-n | ||
| + | * molecular-weight: | ||
| + | ** 283.243 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN0- | + | * [[RXN0-366]] |
| + | * [[RXN0-5199]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN0- | + | * [[RXN-7609]] |
| + | * [[RXN0-5199]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=guanosine}} |
| + | {{#set: inchi-key=inchikey=nyhbqmygnkiuif-uuokfmhzsa-n}} | ||
| + | {{#set: molecular-weight=283.243}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite GUANOSINE
- common-name:
- guanosine
- smiles:
- c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- nyhbqmygnkiuif-uuokfmhzsa-n
- molecular-weight:
- 283.243
