Difference between revisions of "SJ03262"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == * common-name: ** amino-parathion * smiles: ** ccop(oc1(c=c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cis-vaccenoyl-ACPs Cis-vaccenoyl-ACPs] == * common-name: ** a cis-vaccenoyl-[acp] == Reaction(s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cis-vaccenoyl-ACPs Cis-vaccenoyl-ACPs] ==
 
* common-name:
 
* common-name:
** amino-parathion
+
** a cis-vaccenoyl-[acp]
* smiles:
 
** ccop(oc1(c=cc(=cc=1)n))(occ)=s
 
* inchi-key:
 
** xizotxgjxstqdi-uhfffaoysa-n
 
* molecular-weight:
 
** 261.275
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AMINOPARATHION-PHOSPHATASE-RXN]]
+
* [[RXN-17014]]
 +
* [[RXN-17015]]
 +
* [[RXN-17016]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9558]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=amino-parathion}}
+
{{#set: common-name=a cis-vaccenoyl-[acp]}}
{{#set: inchi-key=inchikey=xizotxgjxstqdi-uhfffaoysa-n}}
 
{{#set: molecular-weight=261.275}}
 

Revision as of 09:23, 27 August 2019

Metabolite Cis-vaccenoyl-ACPs

  • common-name:
    • a cis-vaccenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a cis-vaccenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.